C20H23N3O2 — CID 119158205
1-(1-benzofuran-2-ylmethyl)-3-[[3-(hydroxymethyl)phenyl]methyl]-1,2-dimethylguanidine (PubChem CID 119158205) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-3-[[3-(hydroxymethyl)phenyl]methyl]-1,2-dimethylguanidine.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-3-[[3-(hydroxymethyl)phenyl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 119158205 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-3-[[3-(hydroxymethyl)phenyl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCc1cccc(CO)c1)N(C)Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C20H23N3O2/c1-21-20(22-12-15-6-5-7-16(10-15)14-24)23(2)13-18-11-17-8-3-4-9-19(17)25-18/h3-11,24H,12-14H2,1-2H3,(H,21,22) |
| InChIKey | FRMSOUMELXQMJH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|