C14H17NO2 — CID 110732890
N-(1-benzofuran-2-ylmethyl)-N,2-dimethylpropanamide (PubChem CID 110732890) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-N,2-dimethylpropanamide.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110732890 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C14H17NO2/c1-10(2)14(16)15(3)9-12-8-11-6-4-5-7-13(11)17-12/h4-8,10H,9H2,1-3H3 |
| InChIKey | SOVUEXNXACDRAO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |