C15H19NO2 — CID 110732893
N-(1-benzofuran-2-ylmethyl)-N,3-dimethylbutanamide (PubChem CID 110732893) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-N,3-dimethylbutanamide.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 110732893 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C15H19NO2/c1-11(2)8-15(17)16(3)10-13-9-12-6-4-5-7-14(12)18-13/h4-7,9,11H,8,10H2,1-3H3 |
| InChIKey | SXIIOKCXNZLPCU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |