C19H27IN4 — CID 110951993
1-benzyl-3-[[3-(dimethylamino)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 110951993) has the molecular formula C19H27IN4 and a molecular weight of 438.36 g/mol. Its IUPAC name is 1-benzyl-3-[[3-(dimethylamino)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-benzyl-3-[[3-(dimethylamino)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110951993 |
| Molecular Formula | C19H27IN4 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-benzyl-3-[[3-(dimethylamino)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(N(C)C)c1)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C19H26N4.HI/c1-20-19(23(4)15-16-9-6-5-7-10-16)21-14-17-11-8-12-18(13-17)22(2)3;/h5-13H,14-15H2,1-4H3,(H,20,21);1H |
| InChIKey | RSIZSVHTHXILKN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|