C13H21ClFIN4O2S — CID 119131639
1-[(2-chloro-6-fluorophenyl)methyl]-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 119131639) has the molecular formula C13H21ClFIN4O2S and a molecular weight of 478.76 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119131639 |
| Molecular Formula | C13H21ClFIN4O2S |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)N(C)Cc1c(F)cccc1Cl.I |
| InChI | InChI=1S/C13H20ClFN4O2S.HI/c1-16-13(17-7-8-18-22(3,20)21)19(2)9-10-11(14)5-4-6-12(10)15;/h4-6,18H,7-9H2,1-3H3,(H,16,17);1H |
| InChIKey | XRVTZASPCPPGQD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|