C14H18ClFN6 — CID 119131682
1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine (PubChem CID 119131682) has the molecular formula C14H18ClFN6 and a molecular weight of 324.79 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119131682 |
| Molecular Formula | C14H18ClFN6 |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cncn1)N(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H18ClFN6/c1-17-14(19-6-7-22-10-18-9-20-22)21(2)8-11-12(15)4-3-5-13(11)16/h3-5,9-10H,6-8H2,1-2H3,(H,17,19) |
| InChIKey | WVEJAFOJROYBSV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|