C16H24ClFIN3O — CID 119154795
1-[(2-chloro-6-fluorophenyl)methyl]-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 119154795) has the molecular formula C16H24ClFIN3O and a molecular weight of 455.74 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119154795 |
| Molecular Formula | C16H24ClFIN3O |
| Molecular Weight | 455.74 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCC1O)N(C)Cc1c(F)cccc1Cl.I |
| InChI | InChI=1S/C16H23ClFN3O.HI/c1-19-16(20-9-11-5-3-8-15(11)22)21(2)10-12-13(17)6-4-7-14(12)18;/h4,6-7,11,15,22H,3,5,8-10H2,1-2H3,(H,19,20);1H |
| InChIKey | UTPKMTBPNALTEA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|