C15H19ClFN5 — CID 119131656
1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 119131656) has the molecular formula C15H19ClFN5 and a molecular weight of 323.80 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119131656 |
| Molecular Formula | C15H19ClFN5 |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccnn1C)N(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C15H19ClFN5/c1-18-15(19-9-11-7-8-20-22(11)3)21(2)10-12-13(16)5-4-6-14(12)17/h4-8H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | AYPMQIVEVCZBOR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|