C16H20N2O4S — CID 97257545
1-(1-benzofuran-2-ylmethyl)-3-[(3R)-1,1-dioxothian-3-yl]-1-methylurea (PubChem CID 97257545) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-3-[(3R)-1,1-dioxothian-3-yl]-1-methylurea.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-3-[(3R)-1,1-dioxothian-3-yl]-1-methylurea |
|---|---|
| PubChem CID | 97257545 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-3-[(3R)-1,1-dioxothian-3-yl]-1-methylurea |
| SMILES | CN(Cc1cc2ccccc2o1)C(=O)N[C@@H]1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20N2O4S/c1-18(10-14-9-12-5-2-3-7-15(12)22-14)16(19)17-13-6-4-8-23(20,21)11-13/h2-3,5,7,9,13H,4,6,8,10-11H2,1H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | WOZXBPINZDDEOX-CYBMUJFWSA-N |
| XLogP | 2.15 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |