C15H18N2O4S — CID 95277850
3-(1-benzofuran-2-ylmethyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylurea (PubChem CID 95277850) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-(1-benzofuran-2-ylmethyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylurea.
| Compound Name | 3-(1-benzofuran-2-ylmethyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylurea |
|---|---|
| PubChem CID | 95277850 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-(1-benzofuran-2-ylmethyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylurea |
| SMILES | CN(C(=O)NCc1cc2ccccc2o1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O4S/c1-17(12-6-7-22(19,20)10-12)15(18)16-9-13-8-11-4-2-3-5-14(11)21-13/h2-5,8,12H,6-7,9-10H2,1H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | YXBNNFDXIOZAHX-LBPRGKRZSA-N |
| XLogP | 1.76 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |