C19H25N3O3S — CID 119142032
1-(1-benzofuran-2-ylmethyl)-3-cyclopropyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine (PubChem CID 119142032) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-3-cyclopropyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-3-cyclopropyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 119142032 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-3-cyclopropyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine |
| SMILES | CN(Cc1cc2ccccc2o1)/C(=N\CC1CCS(=O)(=O)C1)NC1CC1 |
| InChI | InChI=1S/C19H25N3O3S/c1-22(12-17-10-15-4-2-3-5-18(15)25-17)19(21-16-6-7-16)20-11-14-8-9-26(23,24)13-14/h2-5,10,14,16H,6-9,11-13H2,1H3,(H,20,21) |
| InChIKey | ZEWFYMLDIPWCDS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|