C19H29N3O2S — CID 119139295
1-benzyl-3-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine (PubChem CID 119139295) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 1-benzyl-3-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine.
| Compound Name | 1-benzyl-3-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 119139295 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-benzyl-3-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methylguanidine |
| SMILES | CN(Cc1ccccc1)/C(=N\CC1CCS(=O)(=O)C1)NC1CCCC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-22(14-16-7-3-2-4-8-16)19(21-18-9-5-6-10-18)20-13-17-11-12-25(23,24)15-17/h2-4,7-8,17-18H,5-6,9-15H2,1H3,(H,20,21) |
| InChIKey | WOCNBMQLKGXQEF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|