C18H29N3O3S — CID 111275319
2-[(1,1-dioxothiolan-3-yl)methyl]-1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methylguanidine (PubChem CID 111275319) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methylguanidine.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111275319 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)N(C)Cc1ccc(OCC)cc1 |
| InChI | InChI=1S/C18H29N3O3S/c1-4-19-18(20-12-16-10-11-25(22,23)14-16)21(3)13-15-6-8-17(9-7-15)24-5-2/h6-9,16H,4-5,10-14H2,1-3H3,(H,19,20) |
| InChIKey | IJUSKZNWEMSTNM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|