C16H22N2O2 — CID 108942140
N'-benzyl-N-cyclopentyl-N'-methylpropanediamide (PubChem CID 108942140) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N'-benzyl-N-cyclopentyl-N'-methylpropanediamide.
| Compound Name | N'-benzyl-N-cyclopentyl-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108942140 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N'-benzyl-N-cyclopentyl-N'-methylpropanediamide |
| SMILES | CN(Cc1ccccc1)C(=O)CC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H22N2O2/c1-18(12-13-7-3-2-4-8-13)16(20)11-15(19)17-14-9-5-6-10-14/h2-4,7-8,14H,5-6,9-12H2,1H3,(H,17,19) |
| InChIKey | KOLDBWZYHREDML-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|