C16H17BrN4S — CID 111363465
1-[(5-bromothiophen-2-yl)methyl]-3-[(4-cyanophenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111363465) has the molecular formula C16H17BrN4S and a molecular weight of 377.31 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-[(4-cyanophenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(4-cyanophenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111363465 |
| Molecular Formula | C16H17BrN4S |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(4-cyanophenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCc1ccc(C#N)cc1)N(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C16H17BrN4S/c1-19-16(21(2)11-14-7-8-15(17)22-14)20-10-13-5-3-12(9-18)4-6-13/h3-8H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | RGXPUDMLWWSGHJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|