C15H16BrN3O2S — CID 31792131
N-[(5-bromothiophen-2-yl)methyl]-4-[(carbamoylamino)methyl]-N-methylbenzamide (PubChem CID 31792131) has the molecular formula C15H16BrN3O2S and a molecular weight of 382.28 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-4-[(carbamoylamino)methyl]-N-methylbenzamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-4-[(carbamoylamino)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 31792131 |
| Molecular Formula | C15H16BrN3O2S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-4-[(carbamoylamino)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)c1ccc(CNC(N)=O)cc1 |
| InChI | InChI=1S/C15H16BrN3O2S/c1-19(9-12-6-7-13(16)22-12)14(20)11-4-2-10(3-5-11)8-18-15(17)21/h2-7H,8-9H2,1H3,(H3,17,18,21) |
| InChIKey | ZTCSSILPOAVGQQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |