C20H19BrN2O3S2 — CID 27839495
N-[(5-bromothiophen-2-yl)methyl]-N-methyl-4-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 27839495) has the molecular formula C20H19BrN2O3S2 and a molecular weight of 479.42 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N-methyl-4-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-4-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27839495 |
| Molecular Formula | C20H19BrN2O3S2 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-4-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)N(C)Cc3ccc(Br)s3)cc2)cc1 |
| InChI | InChI=1S/C20H19BrN2O3S2/c1-14-3-7-16(8-4-14)22-28(25,26)18-10-5-15(6-11-18)20(24)23(2)13-17-9-12-19(21)27-17/h3-12,22H,13H2,1-2H3 |
| InChIKey | OKPRIHKCJKIJIN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |