C18H15BrN2O2S2 — CID 27839452
N-[4-[(5-bromothiophen-2-yl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 27839452) has the molecular formula C18H15BrN2O2S2 and a molecular weight of 435.37 g/mol. Its IUPAC name is N-[4-[(5-bromothiophen-2-yl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(5-bromothiophen-2-yl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27839452 |
| Molecular Formula | C18H15BrN2O2S2 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | N-[4-[(5-bromothiophen-2-yl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H15BrN2O2S2/c1-21(11-14-8-9-16(19)25-14)18(23)12-4-6-13(7-5-12)20-17(22)15-3-2-10-24-15/h2-10H,11H2,1H3,(H,20,22) |
| InChIKey | XLFMYYLCDQTXFC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |