C21H18BrN3O3S — CID 30496839
N-[4-[[2-(2-bromoanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 30496839) has the molecular formula C21H18BrN3O3S and a molecular weight of 472.36 g/mol. Its IUPAC name is N-[4-[[2-(2-bromoanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[2-(2-bromoanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 30496839 |
| Molecular Formula | C21H18BrN3O3S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | N-[4-[[2-(2-bromoanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)C(=O)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H18BrN3O3S/c1-25(13-19(26)24-17-6-3-2-5-16(17)22)21(28)14-8-10-15(11-9-14)23-20(27)18-7-4-12-29-18/h2-12H,13H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | VQTRIQSKUORHFD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |