C17H14BrF3N2O3 — CID 4845703
N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethoxy)benzamide (PubChem CID 4845703) has the molecular formula C17H14BrF3N2O3 and a molecular weight of 431.21 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 4845703 |
| Molecular Formula | C17H14BrF3N2O3 |
| Molecular Weight | 431.21 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-4-(trifluoromethoxy)benzamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)C(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14BrF3N2O3/c1-23(10-15(24)22-14-5-3-2-4-13(14)18)16(25)11-6-8-12(9-7-11)26-17(19,20)21/h2-9H,10H2,1H3,(H,22,24) |
| InChIKey | HMJVKKXKVASNOB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |