C10H14BrClN2O — CID 2959503
N-(2-bromophenyl)-2-(dimethylamino)acetamide;hydrochloride (PubChem CID 2959503) has the molecular formula C10H14BrClN2O and a molecular weight of 293.59 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(dimethylamino)acetamide;hydrochloride.
| Compound Name | N-(2-bromophenyl)-2-(dimethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 2959503 |
| Molecular Formula | C10H14BrClN2O |
| Molecular Weight | 293.59 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | N-(2-bromophenyl)-2-(dimethylamino)acetamide;hydrochloride |
| SMILES | CN(C)CC(=O)Nc1ccccc1Br.Cl |
| InChI | InChI=1S/C10H13BrN2O.ClH/c1-13(2)7-10(14)12-9-6-4-3-5-8(9)11;/h3-6H,7H2,1-2H3,(H,12,14);1H |
| InChIKey | FCVMKJPWGXJRLR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |