C13H17BrN4O3 — CID 9252567
N-(2-bromophenyl)-2-[methyl-[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetamide (PubChem CID 9252567) has the molecular formula C13H17BrN4O3 and a molecular weight of 357.21 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[methyl-[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[methyl-[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 9252567 |
| Molecular Formula | C13H17BrN4O3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-(2-bromophenyl)-2-[methyl-[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetamide |
| SMILES | CNC(=O)NC(=O)CN(C)CC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C13H17BrN4O3/c1-15-13(21)17-12(20)8-18(2)7-11(19)16-10-6-4-3-5-9(10)14/h3-6H,7-8H2,1-2H3,(H,16,19)(H2,15,17,20,21) |
| InChIKey | NKIJPMYFKQXDJD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |