C18H20BrN3O2 — CID 9252643
2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-(3-methylphenyl)acetamide (PubChem CID 9252643) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9252643 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN(C)CC(=O)Nc2ccccc2Br)c1 |
| InChI | InChI=1S/C18H20BrN3O2/c1-13-6-5-7-14(10-13)20-17(23)11-22(2)12-18(24)21-16-9-4-3-8-15(16)19/h3-10H,11-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | IFLUPSCJYFBMFB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |