C16H23BrN4O3 — CID 9252556
N-(2-bromophenyl)-2-[[2-(tert-butylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 9252556) has the molecular formula C16H23BrN4O3 and a molecular weight of 399.29 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[[2-(tert-butylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[[2-(tert-butylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 9252556 |
| Molecular Formula | C16H23BrN4O3 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(2-bromophenyl)-2-[[2-(tert-butylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)NC(=O)NC(C)(C)C)CC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C16H23BrN4O3/c1-16(2,3)20-15(24)19-14(23)10-21(4)9-13(22)18-12-8-6-5-7-11(12)17/h5-8H,9-10H2,1-4H3,(H,18,22)(H2,19,20,23,24) |
| InChIKey | GNQHJAJDODYZNA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |