C21H24F3N3O2 — CID 9431728
4-(diethylamino)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]benzamide (PubChem CID 9431728) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 4-(diethylamino)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]benzamide.
| Compound Name | 4-(diethylamino)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 9431728 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-(diethylamino)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)N(C)CC(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-4-27(5-2)16-12-10-15(11-13-16)20(29)26(3)14-19(28)25-18-9-7-6-8-17(18)21(22,23)24/h6-13H,4-5,14H2,1-3H3,(H,25,28) |
| InChIKey | CSDUEWSGBXAMQB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |