C20H19F3N2O4 — CID 26356542
methyl 4-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]carbamoyl]benzoate (PubChem CID 26356542) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is methyl 4-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 26356542 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | methyl 4-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]carbamoyl]benzoate |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-3-25(18(27)13-8-10-14(11-9-13)19(28)29-2)12-17(26)24-16-7-5-4-6-15(16)20(21,22)23/h4-11H,3,12H2,1-2H3,(H,24,26) |
| InChIKey | JJIZJYAOGAQTHH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |