C17H15ClF3N3O2 — CID 26357037
6-chloro-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide (PubChem CID 26357037) has the molecular formula C17H15ClF3N3O2 and a molecular weight of 385.77 g/mol. Its IUPAC name is 6-chloro-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26357037 |
| Molecular Formula | C17H15ClF3N3O2 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 6-chloro-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H15ClF3N3O2/c1-2-24(16(26)11-7-8-14(18)22-9-11)10-15(25)23-13-6-4-3-5-12(13)17(19,20)21/h3-9H,2,10H2,1H3,(H,23,25) |
| InChIKey | LWNHLFUEEZBSFO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|