C21H18ClN3O3S — CID 33289468
N-[2-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 33289468) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is N-[2-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 33289468 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[2-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN(CC(=O)Nc1cccc(Cl)c1)C(=O)c1ccccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C21H18ClN3O3S/c1-25(13-19(26)23-15-7-4-6-14(22)12-15)21(28)16-8-2-3-9-17(16)24-20(27)18-10-5-11-29-18/h2-12H,13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | HTSFTTAJBSWCAR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |