C20H16BrN3O3S — CID 24681758
N-[2-[[2-(2-bromoanilino)-2-oxoethyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 24681758) has the molecular formula C20H16BrN3O3S and a molecular weight of 458.34 g/mol. Its IUPAC name is N-[2-[[2-(2-bromoanilino)-2-oxoethyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[2-(2-bromoanilino)-2-oxoethyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24681758 |
| Molecular Formula | C20H16BrN3O3S |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | N-[2-[[2-(2-bromoanilino)-2-oxoethyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccccc1NC(=O)c1cccs1)Nc1ccccc1Br |
| InChI | InChI=1S/C20H16BrN3O3S/c21-14-7-2-4-9-16(14)23-18(25)12-22-19(26)13-6-1-3-8-15(13)24-20(27)17-10-5-11-28-17/h1-11H,12H2,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | VCUGXJGXMLDUOE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |