C13H13BrN2O2S2 — CID 9108741
N-[2-[(5-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 9108741) has the molecular formula C13H13BrN2O2S2 and a molecular weight of 373.30 g/mol. Its IUPAC name is N-[2-[(5-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(5-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9108741 |
| Molecular Formula | C13H13BrN2O2S2 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | N-[2-[(5-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H13BrN2O2S2/c1-16(8-9-4-5-11(14)20-9)12(17)7-15-13(18)10-3-2-6-19-10/h2-6H,7-8H2,1H3,(H,15,18) |
| InChIKey | VEINGZYBEUJYAF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |