C14H23BrIN3S2 — CID 119158046
1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-(thian-4-ylmethyl)guanidine;hydroiodide (PubChem CID 119158046) has the molecular formula C14H23BrIN3S2 and a molecular weight of 504.30 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-(thian-4-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-(thian-4-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119158046 |
| Molecular Formula | C14H23BrIN3S2 |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 502.96 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-(thian-4-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CCSCC1)N(C)Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C14H22BrN3S2.HI/c1-16-14(17-9-11-5-7-19-8-6-11)18(2)10-12-3-4-13(15)20-12;/h3-4,11H,5-10H2,1-2H3,(H,16,17);1H |
| InChIKey | MTULEWBJBCYYTM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|