C12H18BrN3S — CID 111863259
1-[2-(5-bromothiophen-2-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine (PubChem CID 111863259) has the molecular formula C12H18BrN3S and a molecular weight of 316.27 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111863259 |
| Molecular Formula | C12H18BrN3S |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(Br)s1)NCC1CC1 |
| InChI | InChI=1S/C12H18BrN3S/c1-14-12(16-8-9-2-3-9)15-7-6-10-4-5-11(13)17-10/h4-5,9H,2-3,6-8H2,1H3,(H2,14,15,16) |
| InChIKey | MIZVRRRCBITEME-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|