C13H22BrN3S2 — CID 111609330
1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111609330) has the molecular formula C13H22BrN3S2 and a molecular weight of 364.38 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111609330 |
| Molecular Formula | C13H22BrN3S2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(/NCCc1ccc(Br)s1)NCC(C)(C)SC |
| InChI | InChI=1S/C13H22BrN3S2/c1-13(2,18-4)9-17-12(15-3)16-8-7-10-5-6-11(14)19-10/h5-6H,7-9H2,1-4H3,(H2,15,16,17) |
| InChIKey | NVQJXGQFDICAOB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|