C11H18BrN3S2 — CID 111344113
1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111344113) has the molecular formula C11H18BrN3S2 and a molecular weight of 336.32 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111344113 |
| Molecular Formula | C11H18BrN3S2 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCSC)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C11H18BrN3S2/c1-13-11(15-7-8-16-2)14-6-5-9-3-4-10(12)17-9/h3-4H,5-8H2,1-2H3,(H2,13,14,15) |
| InChIKey | DTXPIQGQKDIGPR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|