C17H30BrIN4OS — CID 111863280
1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111863280) has the molecular formula C17H30BrIN4OS and a molecular weight of 545.33 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863280 |
| Molecular Formula | C17H30BrIN4OS |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(Br)s1)NCC(C(C)C)N1CCOCC1.I |
| InChI | InChI=1S/C17H29BrN4OS.HI/c1-13(2)15(22-8-10-23-11-9-22)12-21-17(19-3)20-7-6-14-4-5-16(18)24-14;/h4-5,13,15H,6-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | JZZXMGWGPNWQKD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|