C18H33N5OS — CID 111931291
1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine (PubChem CID 111931291) has the molecular formula C18H33N5OS and a molecular weight of 367.56 g/mol. Its IUPAC name is 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111931291 |
| Molecular Formula | C18H33N5OS |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
| SMILES | CCc1nc(CCN/C(=N\C)NCC(C(C)C)N2CCOCC2)cs1 |
| InChI | InChI=1S/C18H33N5OS/c1-5-17-22-15(13-25-17)6-7-20-18(19-4)21-12-16(14(2)3)23-8-10-24-11-9-23/h13-14,16H,5-12H2,1-4H3,(H2,19,20,21) |
| InChIKey | XKGKXQTVMQJZRN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|