C16H28BrIN4OS — CID 111931007
1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111931007) has the molecular formula C16H28BrIN4OS and a molecular weight of 531.30 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111931007 |
| Molecular Formula | C16H28BrIN4OS |
| Molecular Weight | 531.30 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Br)s1)NCC(C(C)C)N1CCOCC1.I |
| InChI | InChI=1S/C16H27BrN4OS.HI/c1-12(2)14(21-6-8-22-9-7-21)11-20-16(18-3)19-10-13-4-5-15(17)23-13;/h4-5,12,14H,6-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | WTPYEFIYXZMSSM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|