C18H31N5O — CID 111931204
2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[(6-methyl-2-pyridinyl)methyl]guanidine (PubChem CID 111931204) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[(6-methyl-2-pyridinyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111931204 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(C)n1)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C18H31N5O/c1-14(2)17(23-8-10-24-11-9-23)13-21-18(19-4)20-12-16-7-5-6-15(3)22-16/h5-7,14,17H,8-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | RIPRFNUUPZHBKH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|