C23H33N5O3 — CID 111313070
1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine (PubChem CID 111313070) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111313070 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(C)n1)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H33N5O3/c1-17-6-5-7-19(27-17)15-25-23(24-2)26-16-20(28-10-12-31-13-11-28)18-8-9-21(29-3)22(14-18)30-4/h5-9,14,20H,10-13,15-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | UMBFBOTYBNNPPE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|