C15H17BrFN3S — CID 111863294
1-[2-(5-bromothiophen-2-yl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111863294) has the molecular formula C15H17BrFN3S and a molecular weight of 370.29 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111863294 |
| Molecular Formula | C15H17BrFN3S |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc(Br)s1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C15H17BrFN3S/c1-18-15(19-8-7-13-5-6-14(16)21-13)20-10-11-3-2-4-12(17)9-11/h2-6,9H,7-8,10H2,1H3,(H2,18,19,20) |
| InChIKey | GYSIZSIQTOOPTI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|