C17H20ClFIN3 — CID 111876778
1-[2-(2-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111876778) has the molecular formula C17H20ClFIN3 and a molecular weight of 447.72 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111876778 |
| Molecular Formula | C17H20ClFIN3 |
| Molecular Weight | 447.72 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1Cl)NCc1cccc(F)c1.I |
| InChI | InChI=1S/C17H19ClFN3.HI/c1-20-17(22-12-13-5-4-7-15(19)11-13)21-10-9-14-6-2-3-8-16(14)18;/h2-8,11H,9-10,12H2,1H3,(H2,20,21,22);1H |
| InChIKey | ALOVLNJZAGBYGE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.72 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|