C13H20BrIN6S — CID 111363478
1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111363478) has the molecular formula C13H20BrIN6S and a molecular weight of 499.22 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111363478 |
| Molecular Formula | C13H20BrIN6S |
| Molecular Weight | 499.22 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc(C)n1C)N(C)Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C13H19BrN6S.HI/c1-9-17-18-12(20(9)4)7-16-13(15-2)19(3)8-10-5-6-11(14)21-10;/h5-6H,7-8H2,1-4H3,(H,15,16);1H |
| InChIKey | AAEANJWLHXSLKK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|