C18H28N6O2 — CID 111368059
1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine (PubChem CID 111368059) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111368059 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N(C)Cc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C18H28N6O2/c1-12-8-15(25-6)16(26-7)9-14(12)11-23(4)18(19-3)20-10-17-22-21-13(2)24(17)5/h8-9H,10-11H2,1-7H3,(H,19,20) |
| InChIKey | HOKODMPRRZFBQM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|