C16H24ClIN6O — CID 111419192
1-[2-(3-chlorophenoxy)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111419192) has the molecular formula C16H24ClIN6O and a molecular weight of 478.77 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111419192 |
| Molecular Formula | C16H24ClIN6O |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N(C)CCOc1cccc(Cl)c1.I |
| InChI | InChI=1S/C16H23ClN6O.HI/c1-12-20-21-15(23(12)4)11-19-16(18-2)22(3)8-9-24-14-7-5-6-13(17)10-14;/h5-7,10H,8-9,11H2,1-4H3,(H,18,19);1H |
| InChIKey | VKQZSJYUWGALGK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|