C15H22ClIN6O — CID 75468563
1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 75468563) has the molecular formula C15H22ClIN6O and a molecular weight of 464.74 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75468563 |
| Molecular Formula | C15H22ClIN6O |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncnn1C)N(C)CCOc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C15H21ClN6O.HI/c1-17-15(18-10-14-19-11-20-22(14)3)21(2)8-9-23-13-6-4-12(16)5-7-13;/h4-7,11H,8-10H2,1-3H3,(H,17,18);1H |
| InChIKey | NFPDGTXVMJVPNC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|