C15H21ClN6O — CID 111308178
1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111308178) has the molecular formula C15H21ClN6O and a molecular weight of 336.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111308178 |
| Molecular Formula | C15H21ClN6O |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1nncn1C)N(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN6O/c1-17-15(18-10-14-20-19-11-22(14)3)21(2)8-9-23-13-6-4-12(16)5-7-13/h4-7,11H,8-10H2,1-3H3,(H,17,18) |
| InChIKey | ZUODOFWOHDKCOA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|