C18H28N6O2 — CID 111517264
3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethylguanidine (PubChem CID 111517264) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111517264 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)N(C)CCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H28N6O2/c1-5-17-22-21-14-24(17)11-10-20-18(19-2)23(3)12-13-26-16-8-6-15(25-4)7-9-16/h6-9,14H,5,10-13H2,1-4H3,(H,19,20) |
| InChIKey | YLUZSCCFLBRZSX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|