C19H28ClIN6O — CID 136923605
1-[2-(4-chlorophenoxy)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 136923605) has the molecular formula C19H28ClIN6O and a molecular weight of 518.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136923605 |
| Molecular Formula | C19H28ClIN6O |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\CCn1cnnc1CC)N(C)CCOc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C19H27ClN6O.HI/c1-4-10-21-19(22-11-12-26-15-23-24-18(26)5-2)25(3)13-14-27-17-8-6-16(20)7-9-17;/h4,6-9,15H,1,5,10-14H2,2-3H3,(H,21,22);1H |
| InChIKey | CKEVHCVYVYLTOH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|