C18H28ClIN6O — CID 111515031
1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111515031) has the molecular formula C18H28ClIN6O and a molecular weight of 506.82 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515031 |
| Molecular Formula | C18H28ClIN6O |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCn1cnnc1)N(C)CCOc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C18H27ClN6O.HI/c1-3-20-18(21-10-4-5-11-25-14-22-23-15-25)24(2)12-13-26-17-8-6-16(19)7-9-17;/h6-9,14-15H,3-5,10-13H2,1-2H3,(H,20,21);1H |
| InChIKey | FMVNFVGBIOQIOW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|