C20H32ClN5O2 — CID 111308448
2-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methylguanidine (PubChem CID 111308448) has the molecular formula C20H32ClN5O2 and a molecular weight of 409.96 g/mol. Its IUPAC name is 2-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methylguanidine.
| Compound Name | 2-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111308448 |
| Molecular Formula | C20H32ClN5O2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[2-(4-chlorophenoxy)ethyl]-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CCN1CCN(C(C)=O)CC1)N(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H32ClN5O2/c1-4-22-20(23-9-10-25-11-13-26(14-12-25)17(2)27)24(3)15-16-28-19-7-5-18(21)6-8-19/h5-8H,4,9-16H2,1-3H3,(H,22,23) |
| InChIKey | CZDJMEYYPGMCNA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|